C21H10FN3O2 — CID 142432585
9-(4-fluorophenyl)-2,16-dioxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-5-carbonitrile (PubChem CID 142432585) has the molecular formula C21H10FN3O2 and a molecular weight of 355.33 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-2,16-dioxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-5-carbonitrile.
| Compound Name | 9-(4-fluorophenyl)-2,16-dioxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 142432585 |
| Molecular Formula | C21H10FN3O2 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 9-(4-fluorophenyl)-2,16-dioxo-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,11,13-hexaene-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c(=O)c1c(n2-c2ccc(F)cc2)-c2cccn2C1=O |
| InChI | InChI=1S/C21H10FN3O2/c22-13-4-6-14(7-5-13)25-16-8-3-12(11-23)10-15(16)20(26)18-19(25)17-2-1-9-24(17)21(18)27/h1-10H |
| InChIKey | VOMIIHVWOLEPPM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |