C22H22F4N2O — CID 142432661
2-benzyl-4,4,4-trifluorobutanal;8-fluoro-N,7-dimethylquinolin-3-amine (PubChem CID 142432661) has the molecular formula C22H22F4N2O and a molecular weight of 406.42 g/mol. Its IUPAC name is 2-benzyl-4,4,4-trifluorobutanal;8-fluoro-N,7-dimethylquinolin-3-amine.
| Compound Name | 2-benzyl-4,4,4-trifluorobutanal;8-fluoro-N,7-dimethylquinolin-3-amine |
|---|---|
| PubChem CID | 142432661 |
| Molecular Formula | C22H22F4N2O |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-benzyl-4,4,4-trifluorobutanal;8-fluoro-N,7-dimethylquinolin-3-amine |
| SMILES | CNc1cnc2c(F)c(C)ccc2c1.O=CC(Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C11H11F3O.C11H11FN2/c12-11(13,14)7-10(8-15)6-9-4-2-1-3-5-9;1-7-3-4-8-5-9(13-2)6-14-11(8)10(7)12/h1-5,8,10H,6-7H2;3-6,13H,1-2H3 |
| InChIKey | JRYDLOOBQKNYAD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|