C17H20BN3O4S — CID 142432868
[5-[1-[(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]ethyl]thiophen-2-yl]boronic acid (PubChem CID 142432868) has the molecular formula C17H20BN3O4S and a molecular weight of 373.24 g/mol. Its IUPAC name is [5-[1-[(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]ethyl]thiophen-2-yl]boronic acid.
| Compound Name | [5-[1-[(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]ethyl]thiophen-2-yl]boronic acid |
|---|---|
| PubChem CID | 142432868 |
| Molecular Formula | C17H20BN3O4S |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [5-[1-[(6,7-dimethoxy-2-methylquinazolin-4-yl)amino]ethyl]thiophen-2-yl]boronic acid |
| SMILES | COc1cc2nc(C)nc(NC(C)c3ccc(B(O)O)s3)c2cc1OC |
| InChI | InChI=1S/C17H20BN3O4S/c1-9(15-5-6-16(26-15)18(22)23)19-17-11-7-13(24-3)14(25-4)8-12(11)20-10(2)21-17/h5-9,22-23H,1-4H3,(H,19,20,21) |
| InChIKey | ZEOSZXFREDSHAK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|