C28H43NO2 — CID 142433393
ethane;6-(3-ethoxybut-3-enyl)-2-(3-propan-2-yloxyphenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 142433393) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is ethane;6-(3-ethoxybut-3-enyl)-2-(3-propan-2-yloxyphenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | ethane;6-(3-ethoxybut-3-enyl)-2-(3-propan-2-yloxyphenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 142433393 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | ethane;6-(3-ethoxybut-3-enyl)-2-(3-propan-2-yloxyphenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | C=C(CCc1ccc2c(c1)CCN(c1cccc(OC(C)C)c1)C2)OCC.CC.CC |
| InChI | InChI=1S/C24H31NO2.2C2H6/c1-5-26-19(4)9-10-20-11-12-22-17-25(14-13-21(22)15-20)23-7-6-8-24(16-23)27-18(2)3;2*1-2/h6-8,11-12,15-16,18H,4-5,9-10,13-14,17H2,1-3H3;2*1-2H3 |
| InChIKey | TYBBXLRBEBIBRO-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|