C14H21F3N2O2 — CID 142433533
1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethyl N-[(1S)-cyclopent-2-en-1-yl]carbamate (PubChem CID 142433533) has the molecular formula C14H21F3N2O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethyl N-[(1S)-cyclopent-2-en-1-yl]carbamate.
| Compound Name | 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethyl N-[(1S)-cyclopent-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 142433533 |
| Molecular Formula | C14H21F3N2O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[(2S)-1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]ethyl N-[(1S)-cyclopent-2-en-1-yl]carbamate |
| SMILES | CC(OC(=O)N[C@@H]1C=CCC1)[C@@H]1CCCN1CC(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O2/c1-10(21-13(20)18-11-5-2-3-6-11)12-7-4-8-19(12)9-14(15,16)17/h2,5,10-12H,3-4,6-9H2,1H3,(H,18,20)/t10?,11-,12+/m1/s1 |
| InChIKey | DNDKIGUGDRFTRU-SAIIYOCFSA-N |
| XLogP | 2.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|