C21H18ClF2N3O3 — CID 142433563
3-cyanopropyl N-[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-7-fluoro-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 142433563) has the molecular formula C21H18ClF2N3O3 and a molecular weight of 433.84 g/mol. Its IUPAC name is 3-cyanopropyl N-[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-7-fluoro-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | 3-cyanopropyl N-[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-7-fluoro-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 142433563 |
| Molecular Formula | C21H18ClF2N3O3 |
| Molecular Weight | 433.84 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-cyanopropyl N-[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-7-fluoro-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | N#CCCCOC(=O)N[C@H]1CCc2c(C(=O)Nc3ccc(F)c(Cl)c3)ccc(F)c21 |
| InChI | InChI=1S/C21H18ClF2N3O3/c22-15-11-12(3-6-16(15)23)26-20(28)14-4-7-17(24)19-13(14)5-8-18(19)27-21(29)30-10-2-1-9-25/h3-4,6-7,11,18H,1-2,5,8,10H2,(H,26,28)(H,27,29)/t18-/m0/s1 |
| InChIKey | MSVSGKIDIUKKAY-SFHVURJKSA-N |
| XLogP | 4.89 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|