C28H32FN5O4 — CID 142433735
N-[1-[2-(3-cyano-6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]-3-fluoro-4-nitrobenzamide;propane (PubChem CID 142433735) has the molecular formula C28H32FN5O4 and a molecular weight of 521.59 g/mol. Its IUPAC name is N-[1-[2-(3-cyano-6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]-3-fluoro-4-nitrobenzamide;propane.
| Compound Name | N-[1-[2-(3-cyano-6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]-3-fluoro-4-nitrobenzamide;propane |
|---|---|
| PubChem CID | 142433735 |
| Molecular Formula | C28H32FN5O4 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N-[1-[2-(3-cyano-6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]-3-fluoro-4-nitrobenzamide;propane |
| SMILES | CCC.COc1ccc2ncc(C#N)c(CCN3CCC(NC(=O)c4ccc([N+](=O)[O-])c(F)c4)CC3)c2c1 |
| InChI | InChI=1S/C25H24FN5O4.C3H8/c1-35-19-3-4-23-21(13-19)20(17(14-27)15-28-23)8-11-30-9-6-18(7-10-30)29-25(32)16-2-5-24(31(33)34)22(26)12-16;1-3-2/h2-5,12-13,15,18H,6-11H2,1H3,(H,29,32);3H2,1-2H3 |
| InChIKey | JPNVOZWDNQRSSL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|