About ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole
ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole (PubChem CID 142433791) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole.
Molecular Properties
| Compound Name | ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole |
| PubChem CID | 142433791 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole |
| SMILES | CC.CC(C)c1c2[nH]ccc2cn1C |
| InChI | InChI=1S/C10H14N2.C2H6/c1-7(2)10-9-8(4-5-11-9)6-12(10)3;1-2/h4-7,11H,1-3H3;1-2H3 |
| InChIKey | NAAHJRYMCAJFQG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole?
The IUPAC name of ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole (CID 142433791) is ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole.
What is the SMILES notation for ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole?
The canonical SMILES for ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole is CC.CC(C)c1c2[nH]ccc2cn1C.
What is the InChIKey of ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole?
The InChIKey is NAAHJRYMCAJFQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C2H6/c1-7(2)10-9-8(4-5-11-9)6-12(10)3;1-2/h4-7,11H,1-3H3;1-2H3.
What are the key properties of ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole?
ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole has a molecular weight of 192.31 g/mol, XLogP of 3.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-6-propan-2-yl-1H-pyrrolo[3,4-b]pyrrole is sourced from PubChem (CID 142433791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).