About 1,4-dihydroquinoline;ethane;molecular hydrogen
1,4-dihydroquinoline;ethane;molecular hydrogen (PubChem CID 142433841) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 1,4-dihydroquinoline;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 1,4-dihydroquinoline;ethane;molecular hydrogen |
| PubChem CID | 142433841 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1,4-dihydroquinoline;ethane;molecular hydrogen |
| SMILES | C1=CNc2ccccc2C1.CC.[H][H] |
| InChI | InChI=1S/C9H9N.C2H6.H2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2;/h1-4,6-7,10H,5H2;1-2H3;1H |
| InChIKey | KZZQHFUAJOKJGF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-dihydroquinoline;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroquinoline;ethane;molecular hydrogen?
The IUPAC name of 1,4-dihydroquinoline;ethane;molecular hydrogen (CID 142433841) is 1,4-dihydroquinoline;ethane;molecular hydrogen.
What is the SMILES notation for 1,4-dihydroquinoline;ethane;molecular hydrogen?
The canonical SMILES for 1,4-dihydroquinoline;ethane;molecular hydrogen is C1=CNc2ccccc2C1.CC.[H][H].
What is the InChIKey of 1,4-dihydroquinoline;ethane;molecular hydrogen?
The InChIKey is KZZQHFUAJOKJGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H6.H2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2;/h1-4,6-7,10H,5H2;1-2H3;1H.
What are the key properties of 1,4-dihydroquinoline;ethane;molecular hydrogen?
1,4-dihydroquinoline;ethane;molecular hydrogen has a molecular weight of 163.26 g/mol, XLogP of 3.44, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroquinoline;ethane;molecular hydrogen is sourced from PubChem (CID 142433841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).