C19H20N6O5S — CID 142434805
2-[3-(2-ethoxyethylcarbamoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 142434805) has the molecular formula C19H20N6O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[3-(2-ethoxyethylcarbamoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 2-[3-(2-ethoxyethylcarbamoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 142434805 |
| Molecular Formula | C19H20N6O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[3-(2-ethoxyethylcarbamoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | CCOCCNC(=O)C1CN(c2ncc3c(=O)c(C(=O)O)cn(-c4nccs4)c3n2)C1 |
| InChI | InChI=1S/C19H20N6O5S/c1-2-30-5-3-20-16(27)11-8-24(9-11)18-22-7-12-14(26)13(17(28)29)10-25(15(12)23-18)19-21-4-6-31-19/h4,6-7,10-11H,2-3,5,8-9H2,1H3,(H,20,27)(H,28,29) |
| InChIKey | DIHZRWOWTOCHNL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|