C17H14F3N5O4S — CID 142434817
5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-7-[3-(2,2,2-trifluoro-1-hydroxyethyl)azetidin-1-yl]-1,8-naphthyridine-3-carboxylic acid (PubChem CID 142434817) has the molecular formula C17H14F3N5O4S and a molecular weight of 441.39 g/mol. Its IUPAC name is 5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-7-[3-(2,2,2-trifluoro-1-hydroxyethyl)azetidin-1-yl]-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-7-[3-(2,2,2-trifluoro-1-hydroxyethyl)azetidin-1-yl]-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142434817 |
| Molecular Formula | C17H14F3N5O4S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-7-[3-(2,2,2-trifluoro-1-hydroxyethyl)azetidin-1-yl]-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Cc1cc(N2CC(C(O)C(F)(F)F)C2)nc2c1c(=O)c(C(=O)O)cn2-c1ncns1 |
| InChI | InChI=1S/C17H14F3N5O4S/c1-7-2-10(24-3-8(4-24)13(27)17(18,19)20)23-14-11(7)12(26)9(15(28)29)5-25(14)16-21-6-22-30-16/h2,5-6,8,13,27H,3-4H2,1H3,(H,28,29) |
| InChIKey | YWUTVOGTDSAUJL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |