C15H11FN6O4S — CID 142434864
6-fluoro-7-(3-hydroxyiminoazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 142434864) has the molecular formula C15H11FN6O4S and a molecular weight of 390.36 g/mol. Its IUPAC name is 6-fluoro-7-(3-hydroxyiminoazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 6-fluoro-7-(3-hydroxyiminoazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142434864 |
| Molecular Formula | C15H11FN6O4S |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 6-fluoro-7-(3-hydroxyiminoazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Cc1c(F)c(N2CC(=NO)C2)nc2c1c(=O)c(C(=O)O)cn2-c1ncns1 |
| InChI | InChI=1S/C15H11FN6O4S/c1-6-9-11(23)8(14(24)25)4-22(15-17-5-18-27-15)12(9)19-13(10(6)16)21-2-7(3-21)20-26/h4-5,26H,2-3H2,1H3,(H,24,25) |
| InChIKey | GAFRPRWOGSDGKX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|