C17H16FN5O4S — CID 142435116
7-[3-(dimethylaminooxy)azetidin-1-yl]-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 142435116) has the molecular formula C17H16FN5O4S and a molecular weight of 405.41 g/mol. Its IUPAC name is 7-[3-(dimethylaminooxy)azetidin-1-yl]-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-[3-(dimethylaminooxy)azetidin-1-yl]-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142435116 |
| Molecular Formula | C17H16FN5O4S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 7-[3-(dimethylaminooxy)azetidin-1-yl]-6-fluoro-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CN(C)OC1CN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3-c2nccs2)C1 |
| InChI | InChI=1S/C17H16FN5O4S/c1-21(2)27-9-6-22(7-9)15-12(18)5-10-13(24)11(16(25)26)8-23(14(10)20-15)17-19-3-4-28-17/h3-5,8-9H,6-7H2,1-2H3,(H,25,26) |
| InChIKey | CWOADECGYKOASZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|