About ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate
ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 142435318) has the molecular formula C15H14N4O5S2
and a molecular weight of 394.43 g/mol. Its IUPAC name is ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 142435318 |
| Molecular Formula | C15H14N4O5S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2nccs2)c2nc(S(C)(=O)=O)nc(C)c2c1=O |
| InChI | InChI=1S/C15H14N4O5S2/c1-4-24-13(21)9-7-19(15-16-5-6-25-15)12-10(11(9)20)8(2)17-14(18-12)26(3,22)23/h5-7H,4H2,1-3H3 |
| InChIKey | MBMJCHSFUJQZOU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 121.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
The IUPAC name of ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate (CID 142435318) is ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate is CCOC(=O)c1cn(-c2nccs2)c2nc(S(C)(=O)=O)nc(C)c2c1=O.
What is the InChIKey of ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
The InChIKey is MBMJCHSFUJQZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O5S2/c1-4-24-13(21)9-7-19(15-16-5-6-25-15)12-10(11(9)20)8(2)17-14(18-12)26(3,22)23/h5-7H,4H2,1-3H3.
What are the key properties of ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate?
ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate has a molecular weight of 394.43 g/mol, XLogP of 1.13, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methyl-2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 142435318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).