About 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate
3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate (PubChem CID 142436615) has the molecular formula C17H30N2O7S
and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate.
Molecular Properties
| Compound Name | 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate |
| PubChem CID | 142436615 |
| Molecular Formula | C17H30N2O7S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate |
| SMILES | CCC(=O)OCOC(=O)SC(C)(C)[C@@H](N)C(=O)OCCCN1CCOCC1 |
| InChI | InChI=1S/C17H30N2O7S/c1-4-13(20)25-12-26-16(22)27-17(2,3)14(18)15(21)24-9-5-6-19-7-10-23-11-8-19/h14H,4-12,18H2,1-3H3/t14-/m0/s1 |
| InChIKey | UAGHVOXVPQUSMW-AWEZNQCLSA-N |
| XLogP | 1.14 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate?
The IUPAC name of 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate (CID 142436615) is 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate.
What is the SMILES notation for 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate?
The canonical SMILES for 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate is CCC(=O)OCOC(=O)SC(C)(C)[C@@H](N)C(=O)OCCCN1CCOCC1.
What is the InChIKey of 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate?
The InChIKey is UAGHVOXVPQUSMW-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H30N2O7S/c1-4-13(20)25-12-26-16(22)27-17(2,3)14(18)15(21)24-9-5-6-19-7-10-23-11-8-19/h14H,4-12,18H2,1-3H3/t14-/m0/s1.
What are the key properties of 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate?
3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate has a molecular weight of 406.50 g/mol, XLogP of 1.14, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-ylpropyl (2S)-2-amino-3-methyl-3-(propanoyloxymethoxycarbonylsulfanyl)butanoate is sourced from PubChem (CID 142436615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).