C10H22BNO2 — CID 142436774
(1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine (PubChem CID 142436774) has the molecular formula C10H22BNO2 and a molecular weight of 199.10 g/mol. Its IUPAC name is (1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine.
| Compound Name | (1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 142436774 |
| Molecular Formula | C10H22BNO2 |
| Molecular Weight | 199.10 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-amine |
| SMILES | CC(C)[C@@H](N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H22BNO2/c1-7(2)8(12)11-13-9(3,4)10(5,6)14-11/h7-8H,12H2,1-6H3/t8-/m1/s1 |
| InChIKey | MYYWOAUNNZWFSL-MRVPVSSYSA-N |
| XLogP | 1.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|