C19H13Cl4NO4 — CID 142436809
(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 2-methyl-4-phenylbutanoate (PubChem CID 142436809) has the molecular formula C19H13Cl4NO4 and a molecular weight of 461.13 g/mol. Its IUPAC name is (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 2-methyl-4-phenylbutanoate.
| Compound Name | (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 2-methyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 142436809 |
| Molecular Formula | C19H13Cl4NO4 |
| Molecular Weight | 461.13 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 2-methyl-4-phenylbutanoate |
| SMILES | CC(CCc1ccccc1)C(=O)ON1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C19H13Cl4NO4/c1-9(7-8-10-5-3-2-4-6-10)19(27)28-24-17(25)11-12(18(24)26)14(21)16(23)15(22)13(11)20/h2-6,9H,7-8H2,1H3 |
| InChIKey | PZKUNBJQOCVHKA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.13 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|