About 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one
3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one (PubChem CID 142436848) has the molecular formula C21H29N3O2
and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one |
| PubChem CID | 142436848 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one |
| SMILES | O=C1OC(CCN2CC3(C2)CN(c2ccncc2)C3)CC12CCCCC2 |
| InChI | InChI=1S/C21H29N3O2/c25-19-21(7-2-1-3-8-21)12-18(26-19)6-11-23-13-20(14-23)15-24(16-20)17-4-9-22-10-5-17/h4-5,9-10,18H,1-3,6-8,11-16H2 |
| InChIKey | MTRXOWLUICJVTB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one?
The IUPAC name of 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one (CID 142436848) is 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one.
What is the SMILES notation for 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one?
The canonical SMILES for 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one is O=C1OC(CCN2CC3(C2)CN(c2ccncc2)C3)CC12CCCCC2.
What is the InChIKey of 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one?
The InChIKey is MTRXOWLUICJVTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3O2/c25-19-21(7-2-1-3-8-21)12-18(26-19)6-11-23-13-20(14-23)15-24(16-20)17-4-9-22-10-5-17/h4-5,9-10,18H,1-3,6-8,11-16H2.
What are the key properties of 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one?
3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one has a molecular weight of 355.48 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-pyridin-4-yl-2,6-diazaspiro[3.3]heptan-6-yl)ethyl]-2-oxaspiro[4.5]decan-1-one is sourced from PubChem (CID 142436848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).