About 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran
1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran (PubChem CID 142437271) has the molecular formula C21H29NO3
and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran.
Molecular Properties
| Compound Name | 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran |
| PubChem CID | 142437271 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran |
| SMILES | CCC1=C(CC)CN(C(=O)CCOC)C1.Cc1ccc2occc2c1 |
| InChI | InChI=1S/C12H21NO2.C9H8O/c1-4-10-8-13(9-11(10)5-2)12(14)6-7-15-3;1-7-2-3-9-8(6-7)4-5-10-9/h4-9H2,1-3H3;2-6H,1H3 |
| InChIKey | RLUBQYDKEAOXDO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran?
The IUPAC name of 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran (CID 142437271) is 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran.
What is the SMILES notation for 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran?
The canonical SMILES for 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran is CCC1=C(CC)CN(C(=O)CCOC)C1.Cc1ccc2occc2c1.
What is the InChIKey of 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran?
The InChIKey is RLUBQYDKEAOXDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2.C9H8O/c1-4-10-8-13(9-11(10)5-2)12(14)6-7-15-3;1-7-2-3-9-8(6-7)4-5-10-9/h4-9H2,1-3H3;2-6H,1H3.
What are the key properties of 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran?
1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran has a molecular weight of 343.47 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-diethyl-2,5-dihydropyrrol-1-yl)-3-methoxypropan-1-one;5-methyl-1-benzofuran is sourced from PubChem (CID 142437271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).