About N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane
N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane (PubChem CID 142437297) has the molecular formula C18H35NO2
and a molecular weight of 297.48 g/mol. Its IUPAC name is N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane.
Molecular Properties
| Compound Name | N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane |
| PubChem CID | 142437297 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane |
| SMILES | CC.CCC[C@@H]1C[C@H](NC(C)=O)CC(C2CCCCC2)O1 |
| InChI | InChI=1S/C16H29NO2.C2H6/c1-3-7-15-10-14(17-12(2)18)11-16(19-15)13-8-5-4-6-9-13;1-2/h13-16H,3-11H2,1-2H3,(H,17,18);1-2H3/t14-,15+,16?;/m0./s1 |
| InChIKey | OPJJCQVZALWABR-NKZKTGFWSA-N |
| XLogP | 4.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane?
The IUPAC name of N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane (CID 142437297) is N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane.
What is the SMILES notation for N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane?
The canonical SMILES for N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane is CC.CCC[C@@H]1C[C@H](NC(C)=O)CC(C2CCCCC2)O1.
What is the InChIKey of N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane?
The InChIKey is OPJJCQVZALWABR-NKZKTGFWSA-N. The full InChI is InChI=1S/C16H29NO2.C2H6/c1-3-7-15-10-14(17-12(2)18)11-16(19-15)13-8-5-4-6-9-13;1-2/h13-16H,3-11H2,1-2H3,(H,17,18);1-2H3/t14-,15+,16?;/m0./s1.
What are the key properties of N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane?
N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane has a molecular weight of 297.48 g/mol, XLogP of 4.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S,6R)-2-cyclohexyl-6-propyloxan-4-yl]acetamide;ethane is sourced from PubChem (CID 142437297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).