C17H12F3N3O4 — CID 142438315
methyl 3-[[4-(trifluoromethoxy)benzoyl]amino]-1H-indazole-6-carboxylate (PubChem CID 142438315) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is methyl 3-[[4-(trifluoromethoxy)benzoyl]amino]-1H-indazole-6-carboxylate.
| Compound Name | methyl 3-[[4-(trifluoromethoxy)benzoyl]amino]-1H-indazole-6-carboxylate |
|---|---|
| PubChem CID | 142438315 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | methyl 3-[[4-(trifluoromethoxy)benzoyl]amino]-1H-indazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(NC(=O)c3ccc(OC(F)(F)F)cc3)n[nH]c2c1 |
| InChI | InChI=1S/C17H12F3N3O4/c1-26-16(25)10-4-7-12-13(8-10)22-23-14(12)21-15(24)9-2-5-11(6-3-9)27-17(18,19)20/h2-8H,1H3,(H2,21,22,23,24) |
| InChIKey | CHNGWHQAILUJQS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |