C23H26F2N4O3S — CID 142438600
3,20-difluoro-14-methyl-10-(methylsulfonylmethyl)-13-oxa-5,7,18,25-tetrazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,19,21-octaene (PubChem CID 142438600) has the molecular formula C23H26F2N4O3S and a molecular weight of 476.55 g/mol. Its IUPAC name is 3,20-difluoro-14-methyl-10-(methylsulfonylmethyl)-13-oxa-5,7,18,25-tetrazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,19,21-octaene.
| Compound Name | 3,20-difluoro-14-methyl-10-(methylsulfonylmethyl)-13-oxa-5,7,18,25-tetrazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,19,21-octaene |
|---|---|
| PubChem CID | 142438600 |
| Molecular Formula | C23H26F2N4O3S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3,20-difluoro-14-methyl-10-(methylsulfonylmethyl)-13-oxa-5,7,18,25-tetrazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,19,21-octaene |
| SMILES | CC1CCCNc2cc(ccc2F)-c2nc(ncc2F)NC2=CC(CS(C)(=O)=O)=CC(C2)O1 |
| InChI | InChI=1S/C23H26F2N4O3S/c1-14-4-3-7-26-21-10-16(5-6-19(21)24)22-20(25)12-27-23(29-22)28-17-8-15(13-33(2,30)31)9-18(11-17)32-14/h5-6,8-10,12,14,18,26H,3-4,7,11,13H2,1-2H3,(H,27,28,29) |
| InChIKey | UQGIWJLOLAALGK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |