C9H8F9N — CID 142438884
(Z)-1,1,1,2,2,5-hexafluoro-N-methyl-4-(trifluoromethyl)hept-4-en-3-imine (PubChem CID 142438884) has the molecular formula C9H8F9N and a molecular weight of 301.15 g/mol. Its IUPAC name is (Z)-1,1,1,2,2,5-hexafluoro-N-methyl-4-(trifluoromethyl)hept-4-en-3-imine.
| Compound Name | (Z)-1,1,1,2,2,5-hexafluoro-N-methyl-4-(trifluoromethyl)hept-4-en-3-imine |
|---|---|
| PubChem CID | 142438884 |
| Molecular Formula | C9H8F9N |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (Z)-1,1,1,2,2,5-hexafluoro-N-methyl-4-(trifluoromethyl)hept-4-en-3-imine |
| SMILES | CC/C(F)=C(C(=N/C)\C(F)(F)C(F)(F)F)/C(F)(F)F |
| InChI | InChI=1S/C9H8F9N/c1-3-4(10)5(8(13,14)15)6(19-2)7(11,12)9(16,17)18/h3H2,1-2H3/b5-4-,19-6+ |
| InChIKey | KITOGGKKJZKOGH-KYCOTQASSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|