C18H21NO7 — CID 142438961
6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenyl]benzene-1,2,3,4,5-pentol (PubChem CID 142438961) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenyl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenyl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 142438961 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxazolidin-2-yl)phenyl]benzene-1,2,3,4,5-pentol |
| SMILES | CC1(C)ON(c2ccc(-c3c(O)c(O)c(O)c(O)c3O)cc2)OC1(C)C |
| InChI | InChI=1S/C18H21NO7/c1-17(2)18(3,4)26-19(25-17)10-7-5-9(6-8-10)11-12(20)14(22)16(24)15(23)13(11)21/h5-8,20-24H,1-4H3 |
| InChIKey | KFPRTHLRKYNSOI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|