C10H8FN3O6 — CID 142439102
N-(2-fluoro-5-nitrophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide (PubChem CID 142439102) has the molecular formula C10H8FN3O6 and a molecular weight of 285.19 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 142439102 |
| Molecular Formula | C10H8FN3O6 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-3-hydroxy-5-oxo-1,2-oxazolidine-4-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)C1C(=O)ONC1O |
| InChI | InChI=1S/C10H8FN3O6/c11-5-2-1-4(14(18)19)3-6(5)12-8(15)7-9(16)13-20-10(7)17/h1-3,7,9,13,16H,(H,12,15) |
| InChIKey | HIQBIEBZBNRREP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|