About N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide
N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide (PubChem CID 142439306) has the molecular formula C8H12F2N2O3
and a molecular weight of 222.19 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide |
| PubChem CID | 142439306 |
| Molecular Formula | C8H12F2N2O3 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide |
| SMILES | O=C1NCCC(O)C1C(=O)NCC(F)F |
| InChI | InChI=1S/C8H12F2N2O3/c9-5(10)3-12-8(15)6-4(13)1-2-11-7(6)14/h4-6,13H,1-3H2,(H,11,14)(H,12,15) |
| InChIKey | FPGGQTFJWAMRPE-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide?
The IUPAC name of N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide (CID 142439306) is N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide?
The canonical SMILES for N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide is O=C1NCCC(O)C1C(=O)NCC(F)F.
What is the InChIKey of N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide?
The InChIKey is FPGGQTFJWAMRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2O3/c9-5(10)3-12-8(15)6-4(13)1-2-11-7(6)14/h4-6,13H,1-3H2,(H,11,14)(H,12,15).
What are the key properties of N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide?
N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide has a molecular weight of 222.19 g/mol, XLogP of -1.14, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-4-hydroxy-2-oxopiperidine-3-carboxamide is sourced from PubChem (CID 142439306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).