About 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide
4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide (PubChem CID 142439312) has the molecular formula C9H13F3N2O3
and a molecular weight of 254.21 g/mol. Its IUPAC name is 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide |
| PubChem CID | 142439312 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide |
| SMILES | O=C1NCCC(O)C1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3/c10-9(11,12)2-4-14-8(17)6-5(15)1-3-13-7(6)16/h5-6,15H,1-4H2,(H,13,16)(H,14,17) |
| InChIKey | DXUMDPAOUDGWTB-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide?
The IUPAC name of 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide (CID 142439312) is 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide.
What is the SMILES notation for 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide?
The canonical SMILES for 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide is O=C1NCCC(O)C1C(=O)NCCC(F)(F)F.
What is the InChIKey of 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide?
The InChIKey is DXUMDPAOUDGWTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2O3/c10-9(11,12)2-4-14-8(17)6-5(15)1-3-13-7(6)16/h5-6,15H,1-4H2,(H,13,16)(H,14,17).
What are the key properties of 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide?
4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide has a molecular weight of 254.21 g/mol, XLogP of -0.45, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-oxo-N-(3,3,3-trifluoropropyl)piperidine-3-carboxamide is sourced from PubChem (CID 142439312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).