C40H57N5O7S — CID 142439610
N'-[[4-[1-[6-[[4-[hydroxy(methylamino)methyl]cyclohexyl]methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide (PubChem CID 142439610) has the molecular formula C40H57N5O7S and a molecular weight of 751.99 g/mol. Its IUPAC name is N'-[[4-[1-[6-[[4-[hydroxy(methylamino)methyl]cyclohexyl]methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide.
| Compound Name | N'-[[4-[1-[6-[[4-[hydroxy(methylamino)methyl]cyclohexyl]methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide |
|---|---|
| PubChem CID | 142439610 |
| Molecular Formula | C40H57N5O7S |
| Molecular Weight | 751.99 g/mol |
| Exact Mass | 751.40 |
| IUPAC Name | N'-[[4-[1-[6-[[4-[hydroxy(methylamino)methyl]cyclohexyl]methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide |
| SMILES | CNC(O)C1CCC(CNC(=O)CCCCCN2C(=O)CC(Sc3ccc(CONC(=O)CCCCCCC(=O)Nc4ccccc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C40H57N5O7S/c1-41-39(50)31-21-17-29(18-22-31)27-42-35(46)14-10-5-11-25-45-38(49)26-34(40(45)51)53-33-23-19-30(20-24-33)28-52-44-37(48)16-9-3-2-8-15-36(47)43-32-12-6-4-7-13-32/h4,6-7,12-13,19-20,23-24,29,31,34,39,41,50H,2-3,5,8-11,14-18,21-22,25-28H2,1H3,(H,42,46)(H,43,47)(H,44,48) |
| InChIKey | LJHQPCAHSVYXPF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 166.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.99 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|