C35H48N4O8S — CID 142439656
(2,5-dioxopyrrolidin-1-yl) 4-[[6-[3-(7-anilino-7-oxoheptyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate (PubChem CID 142439656) has the molecular formula C35H48N4O8S and a molecular weight of 684.86 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[6-[3-(7-anilino-7-oxoheptyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[6-[3-(7-anilino-7-oxoheptyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142439656 |
| Molecular Formula | C35H48N4O8S |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[6-[3-(7-anilino-7-oxoheptyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate |
| SMILES | O=C(CCCCCN1C(=O)CC(SCCCCCCC(=O)Nc2ccccc2)C1=O)NCC1CCC(C(=O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C35H48N4O8S/c40-29(36-24-25-15-17-26(18-16-25)35(46)47-39-31(42)19-20-32(39)43)13-8-4-9-21-38-33(44)23-28(34(38)45)48-22-10-2-1-7-14-30(41)37-27-11-5-3-6-12-27/h3,5-6,11-12,25-26,28H,1-2,4,7-10,13-24H2,(H,36,40)(H,37,41) |
| InChIKey | YWJPBOLBXVAMOU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|