C40H54N4O8S — CID 142439659
methyl 4-[[6-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate (PubChem CID 142439659) has the molecular formula C40H54N4O8S and a molecular weight of 750.96 g/mol. Its IUPAC name is methyl 4-[[6-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[6-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142439659 |
| Molecular Formula | C40H54N4O8S |
| Molecular Weight | 750.96 g/mol |
| Exact Mass | 750.37 |
| IUPAC Name | methyl 4-[[6-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoylamino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(CNC(=O)CCCCCN2C(=O)CC(Sc3ccc(CONC(=O)CCCCCCC(=O)Nc4ccccc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C40H54N4O8S/c1-51-40(50)31-21-17-29(18-22-31)27-41-35(45)14-10-5-11-25-44-38(48)26-34(39(44)49)53-33-23-19-30(20-24-33)28-52-43-37(47)16-9-3-2-8-15-36(46)42-32-12-6-4-7-13-32/h4,6-7,12-13,19-20,23-24,29,31,34H,2-3,5,8-11,14-18,21-22,25-28H2,1H3,(H,41,45)(H,42,46)(H,43,47) |
| InChIKey | DFQWCMZOIONXCN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.96 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|