C39H57N5O7S — CID 142439680
N'-[[4-[1-[6-[(4-carbamoylcyclohexyl)methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide;molecular hydrogen (PubChem CID 142439680) has the molecular formula C39H57N5O7S and a molecular weight of 739.98 g/mol. Its IUPAC name is N'-[[4-[1-[6-[(4-carbamoylcyclohexyl)methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide;molecular hydrogen.
| Compound Name | N'-[[4-[1-[6-[(4-carbamoylcyclohexyl)methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide;molecular hydrogen |
|---|---|
| PubChem CID | 142439680 |
| Molecular Formula | C39H57N5O7S |
| Molecular Weight | 739.98 g/mol |
| Exact Mass | 739.40 |
| IUPAC Name | N'-[[4-[1-[6-[(4-carbamoylcyclohexyl)methylamino]-6-oxohexyl]-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]methoxy]-N-phenyloctanediamide;molecular hydrogen |
| SMILES | NC(=O)C1CCC(CNC(=O)CCCCCN2C(=O)CC(Sc3ccc(CONC(=O)CCCCCCC(=O)Nc4ccccc4)cc3)C2=O)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C39H53N5O7S.2H2/c40-38(49)30-20-16-28(17-21-30)26-41-34(45)13-9-4-10-24-44-37(48)25-33(39(44)50)52-32-22-18-29(19-23-32)27-51-43-36(47)15-8-2-1-7-14-35(46)42-31-11-5-3-6-12-31;;/h3,5-6,11-12,18-19,22-23,28,30,33H,1-2,4,7-10,13-17,20-21,24-27H2,(H2,40,49)(H,41,45)(H,42,46)(H,43,47);2*1H |
| InChIKey | IDLNGNFERZVZQR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.98 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|