C21H35NO3 — CID 142439927
2-[(1R,5E)-6,7-dimethoxy-2-(4-methylpentyl)-3,4,7,10-tetrahydro-1H-cycloocta[c]pyridin-1-yl]ethanol (PubChem CID 142439927) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-[(1R,5E)-6,7-dimethoxy-2-(4-methylpentyl)-3,4,7,10-tetrahydro-1H-cycloocta[c]pyridin-1-yl]ethanol.
| Compound Name | 2-[(1R,5E)-6,7-dimethoxy-2-(4-methylpentyl)-3,4,7,10-tetrahydro-1H-cycloocta[c]pyridin-1-yl]ethanol |
|---|---|
| PubChem CID | 142439927 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 2-[(1R,5E)-6,7-dimethoxy-2-(4-methylpentyl)-3,4,7,10-tetrahydro-1H-cycloocta[c]pyridin-1-yl]ethanol |
| SMILES | CO/C1=C/C2=C(CC=CC1OC)[C@@H](CCO)N(CCCC(C)C)CC2 |
| InChI | InChI=1S/C21H35NO3/c1-16(2)7-6-12-22-13-10-17-15-21(25-4)20(24-3)9-5-8-18(17)19(22)11-14-23/h5,9,15-16,19-20,23H,6-8,10-14H2,1-4H3/b9-5?,21-15+/t19-,20?/m1/s1 |
| InChIKey | WGUYMVCBSAYLDP-CSVWHAEDSA-N |
| XLogP | 3.68 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|