About [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate
[3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate (PubChem CID 142440085) has the molecular formula C20H16ClN3O4
and a molecular weight of 397.82 g/mol. Its IUPAC name is [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate.
Molecular Properties
| Compound Name | [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate |
| PubChem CID | 142440085 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccco1)c1cccc(NC(=O)c2cccc(Cl)c2OC)c1 |
| InChI | InChI=1S/C20H16ClN3O4/c1-26-17-14(7-3-8-15(17)21)20(25)24-13-6-2-5-12(11-13)18(22)28-19(23)16-9-4-10-27-16/h2-11,22-23H,1H3,(H,24,25)/b22-18-,23-19+ |
| InChIKey | SURHKQLSOAHRDK-URMAKSPSSA-N |
| XLogP | 4.56 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate?
The IUPAC name of [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate (CID 142440085) is [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate.
What is the SMILES notation for [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate?
The canonical SMILES for [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate is [H]/N=C(\O/C(=N/[H])c1ccco1)c1cccc(NC(=O)c2cccc(Cl)c2OC)c1.
What is the InChIKey of [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate?
The InChIKey is SURHKQLSOAHRDK-URMAKSPSSA-N. The full InChI is InChI=1S/C20H16ClN3O4/c1-26-17-14(7-3-8-15(17)21)20(25)24-13-6-2-5-12(11-13)18(22)28-19(23)16-9-4-10-27-16/h2-11,22-23H,1H3,(H,24,25)/b22-18-,23-19+.
What are the key properties of [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate?
[3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate has a molecular weight of 397.82 g/mol, XLogP of 4.56, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3-chloro-2-methoxybenzoyl)amino]benzenecarboximidoyl] furan-2-carboximidate is sourced from PubChem (CID 142440085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).