About furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate
furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate (PubChem CID 142440207) has the molecular formula C19H13ClF2N4O4
and a molecular weight of 434.79 g/mol. Its IUPAC name is furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate.
Molecular Properties
| Compound Name | furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate |
| PubChem CID | 142440207 |
| Molecular Formula | C19H13ClF2N4O4 |
| Molecular Weight | 434.79 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccco1)c1ccnc(NC(=O)c2cc(Cl)ccc2OC(F)F)c1 |
| InChI | InChI=1S/C19H13ClF2N4O4/c20-11-3-4-13(29-19(21)22)12(9-11)18(27)26-15-8-10(5-6-25-15)16(23)30-17(24)14-2-1-7-28-14/h1-9,19,23-24H,(H,25,26,27)/b23-16-,24-17+ |
| InChIKey | LIZCTTKKPWDGOS-JVBWRSBESA-N |
| XLogP | 4.55 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate?
The IUPAC name of furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate (CID 142440207) is furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate.
What is the SMILES notation for furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate?
The canonical SMILES for furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate is [H]/N=C(\O/C(=N/[H])c1ccco1)c1ccnc(NC(=O)c2cc(Cl)ccc2OC(F)F)c1.
What is the InChIKey of furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate?
The InChIKey is LIZCTTKKPWDGOS-JVBWRSBESA-N. The full InChI is InChI=1S/C19H13ClF2N4O4/c20-11-3-4-13(29-19(21)22)12(9-11)18(27)26-15-8-10(5-6-25-15)16(23)30-17(24)14-2-1-7-28-14/h1-9,19,23-24H,(H,25,26,27)/b23-16-,24-17+.
What are the key properties of furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate?
furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate has a molecular weight of 434.79 g/mol, XLogP of 4.55, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carboximidoyl 2-[[5-chloro-2-(difluoromethoxy)benzoyl]amino]pyridine-4-carboximidate is sourced from PubChem (CID 142440207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).