C18H11FN4O3 — CID 142440215
2-fluoro-N-[3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl]pyridine-3-carboxamide (PubChem CID 142440215) has the molecular formula C18H11FN4O3 and a molecular weight of 350.31 g/mol. Its IUPAC name is 2-fluoro-N-[3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142440215 |
| Molecular Formula | C18H11FN4O3 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-fluoro-N-[3-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nnc(-c3ccco3)o2)c1)c1cccnc1F |
| InChI | InChI=1S/C18H11FN4O3/c19-15-13(6-2-8-20-15)16(24)21-12-5-1-4-11(10-12)17-22-23-18(26-17)14-7-3-9-25-14/h1-10H,(H,21,24) |
| InChIKey | HMLWXLJRONRSTH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|