C27H24BrCl2FINO4S — CID 142440937
6-bromo-3-(4-chlorophenyl)-2-[1-(4-chlorophenyl)propyl]-4-fluoro-3-methoxyisoindol-1-one;2-iodosulfanylethyl formate (PubChem CID 142440937) has the molecular formula C27H24BrCl2FINO4S and a molecular weight of 755.27 g/mol. Its IUPAC name is 6-bromo-3-(4-chlorophenyl)-2-[1-(4-chlorophenyl)propyl]-4-fluoro-3-methoxyisoindol-1-one;2-iodosulfanylethyl formate.
| Compound Name | 6-bromo-3-(4-chlorophenyl)-2-[1-(4-chlorophenyl)propyl]-4-fluoro-3-methoxyisoindol-1-one;2-iodosulfanylethyl formate |
|---|---|
| PubChem CID | 142440937 |
| Molecular Formula | C27H24BrCl2FINO4S |
| Molecular Weight | 755.27 g/mol |
| Exact Mass | 752.90 |
| IUPAC Name | 6-bromo-3-(4-chlorophenyl)-2-[1-(4-chlorophenyl)propyl]-4-fluoro-3-methoxyisoindol-1-one;2-iodosulfanylethyl formate |
| SMILES | CCC(c1ccc(Cl)cc1)N1C(=O)c2cc(Br)cc(F)c2C1(OC)c1ccc(Cl)cc1.O=COCCSI |
| InChI | InChI=1S/C24H19BrCl2FNO2.C3H5IO2S/c1-3-21(14-4-8-17(26)9-5-14)29-23(30)19-12-16(25)13-20(28)22(19)24(29,31-2)15-6-10-18(27)11-7-15;4-7-2-1-6-3-5/h4-13,21H,3H2,1-2H3;3H,1-2H2 |
| InChIKey | YRUONDYZWNEFGW-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.27 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|