About butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol
butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol (PubChem CID 142440975) has the molecular formula C18H32FN3O5
and a molecular weight of 389.47 g/mol. Its IUPAC name is butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol.
Molecular Properties
| Compound Name | butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol |
| PubChem CID | 142440975 |
| Molecular Formula | C18H32FN3O5 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol |
| SMILES | CCCCOC(=O)Nc1nc(=O)n([C@H](CC)OCC(C)CC)cc1F.CO |
| InChI | InChI=1S/C17H28FN3O4.CH4O/c1-5-8-9-24-17(23)20-15-13(18)10-21(16(22)19-15)14(7-3)25-11-12(4)6-2;1-2/h10,12,14H,5-9,11H2,1-4H3,(H,19,20,22,23);2H,1H3/t12?,14-;/m0./s1 |
| InChIKey | RSEPOIMUSKPMNB-KQYRMMKASA-N |
| XLogP | 3.31 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol?
The IUPAC name of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol (CID 142440975) is butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol.
What is the SMILES notation for butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol?
The canonical SMILES for butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol is CCCCOC(=O)Nc1nc(=O)n([C@H](CC)OCC(C)CC)cc1F.CO.
What is the InChIKey of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol?
The InChIKey is RSEPOIMUSKPMNB-KQYRMMKASA-N. The full InChI is InChI=1S/C17H28FN3O4.CH4O/c1-5-8-9-24-17(23)20-15-13(18)10-21(16(22)19-15)14(7-3)25-11-12(4)6-2;1-2/h10,12,14H,5-9,11H2,1-4H3,(H,19,20,22,23);2H,1H3/t12?,14-;/m0./s1.
What are the key properties of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol?
butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol has a molecular weight of 389.47 g/mol, XLogP of 3.31, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;methanol is sourced from PubChem (CID 142440975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).