About butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate
butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate (PubChem CID 142441003) has the molecular formula C23H40FN3O7
and a molecular weight of 489.59 g/mol. Its IUPAC name is butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate.
Molecular Properties
| Compound Name | butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate |
| PubChem CID | 142441003 |
| Molecular Formula | C23H40FN3O7 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate |
| SMILES | CCCCOC(=O)Nc1nc(=O)n([C@H](CC)OCC(C)CC)cc1F.CCCCOC(=O)OC |
| InChI | InChI=1S/C17H28FN3O4.C6H12O3/c1-5-8-9-24-17(23)20-15-13(18)10-21(16(22)19-15)14(7-3)25-11-12(4)6-2;1-3-4-5-9-6(7)8-2/h10,12,14H,5-9,11H2,1-4H3,(H,19,20,22,23);3-5H2,1-2H3/t12?,14-;/m0./s1 |
| InChIKey | WWKNCJPBUWSAJP-KQYRMMKASA-N |
| XLogP | 5.27 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate?
The IUPAC name of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate (CID 142441003) is butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate.
What is the SMILES notation for butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate?
The canonical SMILES for butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate is CCCCOC(=O)Nc1nc(=O)n([C@H](CC)OCC(C)CC)cc1F.CCCCOC(=O)OC.
What is the InChIKey of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate?
The InChIKey is WWKNCJPBUWSAJP-KQYRMMKASA-N. The full InChI is InChI=1S/C17H28FN3O4.C6H12O3/c1-5-8-9-24-17(23)20-15-13(18)10-21(16(22)19-15)14(7-3)25-11-12(4)6-2;1-3-4-5-9-6(7)8-2/h10,12,14H,5-9,11H2,1-4H3,(H,19,20,22,23);3-5H2,1-2H3/t12?,14-;/m0./s1.
What are the key properties of butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate?
butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate has a molecular weight of 489.59 g/mol, XLogP of 5.27, 13 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate;butyl methyl carbonate is sourced from PubChem (CID 142441003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).