About 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane
4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane (PubChem CID 142441009) has the molecular formula C21H38FN3O6
and a molecular weight of 447.55 g/mol. Its IUPAC name is 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane.
Molecular Properties
| Compound Name | 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane |
| PubChem CID | 142441009 |
| Molecular Formula | C21H38FN3O6 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane |
| SMILES | C=C(Nc1nc(=O)n(C)cc1F)OCC.CCCOCC(C)CC.CCOC(=O)OC |
| InChI | InChI=1S/C9H12FN3O2.C8H18O.C4H8O3/c1-4-15-6(2)11-8-7(10)5-13(3)9(14)12-8;1-4-6-9-7-8(3)5-2;1-3-7-4(5)6-2/h5H,2,4H2,1,3H3,(H,11,12,14);8H,4-7H2,1-3H3;3H2,1-2H3 |
| InChIKey | MJUBFHUPSAESHW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane?
The IUPAC name of 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane (CID 142441009) is 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane.
What is the SMILES notation for 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane?
The canonical SMILES for 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane is C=C(Nc1nc(=O)n(C)cc1F)OCC.CCCOCC(C)CC.CCOC(=O)OC.
What is the InChIKey of 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane?
The InChIKey is MJUBFHUPSAESHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN3O2.C8H18O.C4H8O3/c1-4-15-6(2)11-8-7(10)5-13(3)9(14)12-8;1-4-6-9-7-8(3)5-2;1-3-7-4(5)6-2/h5H,2,4H2,1,3H3,(H,11,12,14);8H,4-7H2,1-3H3;3H2,1-2H3.
What are the key properties of 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane?
4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane has a molecular weight of 447.55 g/mol, XLogP of 4.09, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethoxyethenylamino)-5-fluoro-1-methylpyrimidin-2-one;ethyl methyl carbonate;2-methyl-1-propoxybutane is sourced from PubChem (CID 142441009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).