C25H32N4O6 — CID 142441503
ethyl (3S)-3-cyclopropyl-3-[2-[[1-(2-methoxy-5-nitro-4-pyridinyl)piperidin-4-yl]methoxy]-4-pyridinyl]propanoate (PubChem CID 142441503) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is ethyl (3S)-3-cyclopropyl-3-[2-[[1-(2-methoxy-5-nitro-4-pyridinyl)piperidin-4-yl]methoxy]-4-pyridinyl]propanoate.
| Compound Name | ethyl (3S)-3-cyclopropyl-3-[2-[[1-(2-methoxy-5-nitro-4-pyridinyl)piperidin-4-yl]methoxy]-4-pyridinyl]propanoate |
|---|---|
| PubChem CID | 142441503 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | ethyl (3S)-3-cyclopropyl-3-[2-[[1-(2-methoxy-5-nitro-4-pyridinyl)piperidin-4-yl]methoxy]-4-pyridinyl]propanoate |
| SMILES | CCOC(=O)C[C@H](c1ccnc(OCC2CCN(c3cc(OC)ncc3[N+](=O)[O-])CC2)c1)C1CC1 |
| InChI | InChI=1S/C25H32N4O6/c1-3-34-25(30)13-20(18-4-5-18)19-6-9-26-24(12-19)35-16-17-7-10-28(11-8-17)21-14-23(33-2)27-15-22(21)29(31)32/h6,9,12,14-15,17-18,20H,3-5,7-8,10-11,13,16H2,1-2H3/t20-/m0/s1 |
| InChIKey | VVMHGSMSZTWFHO-FQEVSTJZSA-N |
| XLogP | 4.14 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|