C23H25Cl2NO2S — CID 142441727
N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]benzenesulfonamide (PubChem CID 142441727) has the molecular formula C23H25Cl2NO2S and a molecular weight of 450.43 g/mol. Its IUPAC name is N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]benzenesulfonamide.
| Compound Name | N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142441727 |
| Molecular Formula | C23H25Cl2NO2S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H](c1ccccc1)[C@H]1[C@H]2C[C@@H]3C[C@](Cl)(C2)C[C@@]1(Cl)C3)c1ccccc1 |
| InChI | InChI=1S/C23H25Cl2NO2S/c24-22-12-16-11-18(14-22)20(23(25,13-16)15-22)21(17-7-3-1-4-8-17)26-29(27,28)19-9-5-2-6-10-19/h1-10,16,18,20-21,26H,11-15H2/t16-,18+,20-,21+,22+,23+/m1/s1 |
| InChIKey | VXTBSIMOCDWHOR-MLDIIPNJSA-N |
| XLogP | 5.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|