About N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide
N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide (PubChem CID 142441870) has the molecular formula C20H36N2O4
and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide |
| PubChem CID | 142441870 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide |
| SMILES | CCCCCCCCCCc1cc(CCC(CO)(CO)NC(C)=O)on1 |
| InChI | InChI=1S/C20H36N2O4/c1-3-4-5-6-7-8-9-10-11-18-14-19(26-22-18)12-13-20(15-23,16-24)21-17(2)25/h14,23-24H,3-13,15-16H2,1-2H3,(H,21,25) |
| InChIKey | ZFTKONFHBAOMGQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide?
The IUPAC name of N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide (CID 142441870) is N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide.
What is the SMILES notation for N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide?
The canonical SMILES for N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide is CCCCCCCCCCc1cc(CCC(CO)(CO)NC(C)=O)on1.
What is the InChIKey of N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide?
The InChIKey is ZFTKONFHBAOMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2O4/c1-3-4-5-6-7-8-9-10-11-18-14-19(26-22-18)12-13-20(15-23,16-24)21-17(2)25/h14,23-24H,3-13,15-16H2,1-2H3,(H,21,25).
What are the key properties of N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide?
N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide has a molecular weight of 368.52 g/mol, XLogP of 3.15, 15 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-decyl-1,2-oxazol-5-yl)-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide is sourced from PubChem (CID 142441870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).