About (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal
(4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal (PubChem CID 142442632) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal.
Molecular Properties
| Compound Name | (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal |
| PubChem CID | 142442632 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal |
| SMILES | C=C/C=C(\C=C1\C=CC=CC1)CCC=O |
| InChI | InChI=1S/C14H16O/c1-2-7-13(10-6-11-15)12-14-8-4-3-5-9-14/h2-5,7-8,11-12H,1,6,9-10H2/b13-7-,14-12- |
| InChIKey | FLMJJLAXWSIQQR-NQHPWHPZSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal?
The IUPAC name of (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal (CID 142442632) is (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal.
What is the SMILES notation for (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal?
The canonical SMILES for (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal is C=C/C=C(\C=C1\C=CC=CC1)CCC=O.
What is the InChIKey of (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal?
The InChIKey is FLMJJLAXWSIQQR-NQHPWHPZSA-N. The full InChI is InChI=1S/C14H16O/c1-2-7-13(10-6-11-15)12-14-8-4-3-5-9-14/h2-5,7-8,11-12H,1,6,9-10H2/b13-7-,14-12-.
What are the key properties of (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal?
(4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal has a molecular weight of 200.28 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]hepta-4,6-dienal is sourced from PubChem (CID 142442632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).