C33H50N6O5 — CID 142442802
(2S)-2-[[(2S,3S)-2-[[(2S)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-methylpentanoyl]amino]-6-amino-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]hexanamide (PubChem CID 142442802) has the molecular formula C33H50N6O5 and a molecular weight of 610.80 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-[[(2S)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-methylpentanoyl]amino]-6-amino-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]hexanamide.
| Compound Name | (2S)-2-[[(2S,3S)-2-[[(2S)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-methylpentanoyl]amino]-6-amino-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 142442802 |
| Molecular Formula | C33H50N6O5 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-[[(2S)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-methylpentanoyl]amino]-6-amino-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]hexanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc2ccccc2c1)NC(C)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C33H50N6O5/c1-6-21(4)29(33(44)37-26(13-9-10-16-34)31(42)38-27(30(35)41)17-20(2)3)39-32(43)28(36-22(5)40)19-23-14-15-24-11-7-8-12-25(24)18-23/h7-8,11-12,14-15,18,20-21,26-29H,6,9-10,13,16-17,19,34H2,1-5H3,(H2,35,41)(H,36,40)(H,37,44)(H,38,42)(H,39,43)/t21-,26-,27-,28-,29-/m0/s1 |
| InChIKey | UYRKYQUOQXOZNK-VRTFYRIBSA-N |
| XLogP | 2.05 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|