C35H48ClF3N2O5S — CID 142443399
3-(4-chloro-2-propylphenyl)-5-[[2-[(E)-1-hydroxyhex-3-en-2-yl]cyclobutyl]methyl]-N-propan-2-ylsulfinyl-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide;2,2,2-trifluoroethanol (PubChem CID 142443399) has the molecular formula C35H48ClF3N2O5S and a molecular weight of 701.29 g/mol. Its IUPAC name is 3-(4-chloro-2-propylphenyl)-5-[[2-[(E)-1-hydroxyhex-3-en-2-yl]cyclobutyl]methyl]-N-propan-2-ylsulfinyl-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide;2,2,2-trifluoroethanol.
| Compound Name | 3-(4-chloro-2-propylphenyl)-5-[[2-[(E)-1-hydroxyhex-3-en-2-yl]cyclobutyl]methyl]-N-propan-2-ylsulfinyl-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide;2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 142443399 |
| Molecular Formula | C35H48ClF3N2O5S |
| Molecular Weight | 701.29 g/mol |
| Exact Mass | 700.29 |
| IUPAC Name | 3-(4-chloro-2-propylphenyl)-5-[[2-[(E)-1-hydroxyhex-3-en-2-yl]cyclobutyl]methyl]-N-propan-2-ylsulfinyl-3,4-dihydro-2H-1,5-benzoxazepine-7-carboxamide;2,2,2-trifluoroethanol |
| SMILES | CC/C=C/C(CO)C1CCC1CN1CC(c2ccc(Cl)cc2CCC)COc2ccc(C(=O)NS(=O)C(C)C)cc21.OCC(F)(F)F |
| InChI | InChI=1S/C33H45ClN2O4S.C2H3F3O/c1-5-7-9-26(20-37)30-13-10-25(30)18-36-19-27(29-14-12-28(34)16-23(29)8-6-2)21-40-32-15-11-24(17-31(32)36)33(38)35-41(39)22(3)4;3-2(4,5)1-6/h7,9,11-12,14-17,22,25-27,30,37H,5-6,8,10,13,18-21H2,1-4H3,(H,35,38);6H,1H2/b9-7+; |
| InChIKey | HYIDVBGJARTWMD-BXTVWIJMSA-N |
| XLogP | 7.22 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.29 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|