C33H43ClN2O3S — CID 142443624
(6E)-7'-chloro-4-ethyl-5-hydroxy-3,9,10-trimethylspiro[18-oxa-11-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-one (PubChem CID 142443624) has the molecular formula C33H43ClN2O3S and a molecular weight of 583.24 g/mol. Its IUPAC name is (6E)-7'-chloro-4-ethyl-5-hydroxy-3,9,10-trimethylspiro[18-oxa-11-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-one.
| Compound Name | (6E)-7'-chloro-4-ethyl-5-hydroxy-3,9,10-trimethylspiro[18-oxa-11-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-one |
|---|---|
| PubChem CID | 142443624 |
| Molecular Formula | C33H43ClN2O3S |
| Molecular Weight | 583.24 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | (6E)-7'-chloro-4-ethyl-5-hydroxy-3,9,10-trimethylspiro[18-oxa-11-thia-1,12-diazatricyclo[12.7.2.017,22]tricosa-6,14(23),15,17(22)-tetraene-20,4'-2,3-dihydro-1H-naphthalene]-13-one |
| SMILES | CCC1C(O)/C=C/CC(C)C(C)SNC(=O)c2ccc3c(c2)N(CC1C)CC1(CCCc2cc(Cl)ccc21)CO3 |
| InChI | InChI=1S/C33H43ClN2O3S/c1-5-27-22(3)18-36-19-33(15-7-9-24-16-26(34)12-13-28(24)33)20-39-31-14-11-25(17-29(31)36)32(38)35-40-23(4)21(2)8-6-10-30(27)37/h6,10-14,16-17,21-23,27,30,37H,5,7-9,15,18-20H2,1-4H3,(H,35,38)/b10-6+ |
| InChIKey | MSXNWNNDXXYUOU-UXBLZVDNSA-N |
| XLogP | 7.20 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.24 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|