About CID 142443882
CID 142443882 (PubChem CID 142443882) has the molecular formula C11H23N4
and a molecular weight of 211.33 g/mol.
Molecular Properties
| Compound Name | CID 142443882 |
| PubChem CID | 142443882 |
| Molecular Formula | C11H23N4 |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | — |
| SMILES | CC.CCN(CCNC)C1=CN=C[CH]N1 |
| InChI | InChI=1S/C9H17N4.C2H6/c1-3-13(7-6-10-2)9-8-11-4-5-12-9;1-2/h4-5,8,10,12H,3,6-7H2,1-2H3;1-2H3 |
| InChIKey | XJUSVCDRGDRZMI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 142443882 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142443882?
The IUPAC name of CID 142443882 (CID 142443882) is not available.
What is the SMILES notation for CID 142443882?
The canonical SMILES for CID 142443882 is CC.CCN(CCNC)C1=CN=C[CH]N1.
What is the InChIKey of CID 142443882?
The InChIKey is XJUSVCDRGDRZMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N4.C2H6/c1-3-13(7-6-10-2)9-8-11-4-5-12-9;1-2/h4-5,8,10,12H,3,6-7H2,1-2H3;1-2H3.
What are the key properties of CID 142443882?
CID 142443882 has a molecular weight of 211.33 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142443882 is sourced from PubChem (CID 142443882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).