About ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide
ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide (PubChem CID 142443940) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide.
Molecular Properties
| Compound Name | ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide |
| PubChem CID | 142443940 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide |
| SMILES | C=C/N=C(/CN1CCNCC1)N=C.CC |
| InChI | InChI=1S/C9H16N4.C2H6/c1-3-12-9(10-2)8-13-6-4-11-5-7-13;1-2/h3,11H,1-2,4-8H2;1-2H3/b12-9-; |
| InChIKey | LJBPFWMUCUNANH-MWMYENNMSA-N |
| XLogP | 1.16 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide?
The IUPAC name of ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide (CID 142443940) is ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide.
What is the SMILES notation for ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide?
The canonical SMILES for ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide is C=C/N=C(/CN1CCNCC1)N=C.CC.
What is the InChIKey of ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide?
The InChIKey is LJBPFWMUCUNANH-MWMYENNMSA-N. The full InChI is InChI=1S/C9H16N4.C2H6/c1-3-12-9(10-2)8-13-6-4-11-5-7-13;1-2/h3,11H,1-2,4-8H2;1-2H3/b12-9-;.
What are the key properties of ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide?
ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide has a molecular weight of 210.32 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-ethenyl-N-methylidene-2-piperazin-1-ylethanimidamide is sourced from PubChem (CID 142443940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).