C10H20N2O — CID 142444179
3-methoxy-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine (PubChem CID 142444179) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-methoxy-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine.
| Compound Name | 3-methoxy-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine |
|---|---|
| PubChem CID | 142444179 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-methoxy-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1H-2,6-naphthyridine |
| SMILES | COC1CC2CN(C)CCC2CN1 |
| InChI | InChI=1S/C10H20N2O/c1-12-4-3-8-6-11-10(13-2)5-9(8)7-12/h8-11H,3-7H2,1-2H3 |
| InChIKey | QLHRGRRQZUOFHI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |