C8H17NO2 — CID 142444795
2,5-dioxa-8-azaspiro[3.5]nonane;ethane (PubChem CID 142444795) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 2,5-dioxa-8-azaspiro[3.5]nonane;ethane.
| Compound Name | 2,5-dioxa-8-azaspiro[3.5]nonane;ethane |
|---|---|
| PubChem CID | 142444795 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2,5-dioxa-8-azaspiro[3.5]nonane;ethane |
| SMILES | C1COC2(CN1)COC2.CC |
| InChI | InChI=1S/C6H11NO2.C2H6/c1-2-9-6(3-7-1)4-8-5-6;1-2/h7H,1-5H2;1-2H3 |
| InChIKey | VXHNGLSLORWBJV-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |